C13H17ClF3N3 — CID 62592867
N-[[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrrolidin-2-yl]methyl]ethanamine (PubChem CID 62592867) has the molecular formula C13H17ClF3N3 and a molecular weight of 307.75 g/mol. Its IUPAC name is N-[[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrrolidin-2-yl]methyl]ethanamine.
| Compound Name | N-[[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrrolidin-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 62592867 |
| Molecular Formula | C13H17ClF3N3 |
| Molecular Weight | 307.75 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | N-[[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrrolidin-2-yl]methyl]ethanamine |
| SMILES | CCNCC1CCCN1c1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C13H17ClF3N3/c1-2-18-8-10-4-3-5-20(10)12-11(14)6-9(7-19-12)13(15,16)17/h6-7,10,18H,2-5,8H2,1H3 |
| InChIKey | TWPPJNFNHPDICU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.75 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |