C14H12F2N2S — CID 103586198
4-(2,5-difluoro-4-methylanilino)benzenecarbothioamide (PubChem CID 103586198) has the molecular formula C14H12F2N2S and a molecular weight of 278.33 g/mol. Its IUPAC name is 4-(2,5-difluoro-4-methylanilino)benzenecarbothioamide.
| Compound Name | 4-(2,5-difluoro-4-methylanilino)benzenecarbothioamide |
|---|---|
| PubChem CID | 103586198 |
| Molecular Formula | C14H12F2N2S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 4-(2,5-difluoro-4-methylanilino)benzenecarbothioamide |
| SMILES | Cc1cc(F)c(Nc2ccc(C(N)=S)cc2)cc1F |
| InChI | InChI=1S/C14H12F2N2S/c1-8-6-12(16)13(7-11(8)15)18-10-4-2-9(3-5-10)14(17)19/h2-7,18H,1H3,(H2,17,19) |
| InChIKey | SISDSTBRLBZROW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|