C12H7Cl2F2NO3 — CID 10358731
methyl 5-[chloro(difluoro)methyl]-3-(4-chlorophenyl)-1,2-oxazole-4-carboxylate (PubChem CID 10358731) has the molecular formula C12H7Cl2F2NO3 and a molecular weight of 322.09 g/mol. Its IUPAC name is methyl 5-[chloro(difluoro)methyl]-3-(4-chlorophenyl)-1,2-oxazole-4-carboxylate.
| Compound Name | methyl 5-[chloro(difluoro)methyl]-3-(4-chlorophenyl)-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 10358731 |
| Molecular Formula | C12H7Cl2F2NO3 |
| Molecular Weight | 322.09 g/mol |
| Exact Mass | 320.98 |
| IUPAC Name | methyl 5-[chloro(difluoro)methyl]-3-(4-chlorophenyl)-1,2-oxazole-4-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(Cl)cc2)noc1C(F)(F)Cl |
| InChI | InChI=1S/C12H7Cl2F2NO3/c1-19-11(18)8-9(6-2-4-7(13)5-3-6)17-20-10(8)12(14,15)16/h2-5H,1H3 |
| InChIKey | TVFTUGXAUJCMSZ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.09 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|