C15H10ClF6NO3 — CID 15514968
ethyl 5-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-3-phenyl-1,2-oxazole-4-carboxylate (PubChem CID 15514968) has the molecular formula C15H10ClF6NO3 and a molecular weight of 401.69 g/mol. Its IUPAC name is ethyl 5-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-3-phenyl-1,2-oxazole-4-carboxylate.
| Compound Name | ethyl 5-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-3-phenyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 15514968 |
| Molecular Formula | C15H10ClF6NO3 |
| Molecular Weight | 401.69 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | ethyl 5-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-3-phenyl-1,2-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)noc1C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C15H10ClF6NO3/c1-2-25-12(24)9-10(8-6-4-3-5-7-8)23-26-11(9)13(17,18)14(19,20)15(16,21)22/h3-7H,2H2,1H3 |
| InChIKey | QZJSIOYBYUUOHA-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.69 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|