C13H10BrF2NO3 — CID 23236715
ethyl 5-[bromo(difluoro)methyl]-3-phenyl-1,2-oxazole-4-carboxylate (PubChem CID 23236715) has the molecular formula C13H10BrF2NO3 and a molecular weight of 346.13 g/mol. Its IUPAC name is ethyl 5-[bromo(difluoro)methyl]-3-phenyl-1,2-oxazole-4-carboxylate.
| Compound Name | ethyl 5-[bromo(difluoro)methyl]-3-phenyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 23236715 |
| Molecular Formula | C13H10BrF2NO3 |
| Molecular Weight | 346.13 g/mol |
| Exact Mass | 344.98 |
| IUPAC Name | ethyl 5-[bromo(difluoro)methyl]-3-phenyl-1,2-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)noc1C(F)(F)Br |
| InChI | InChI=1S/C13H10BrF2NO3/c1-2-19-12(18)9-10(8-6-4-3-5-7-8)17-20-11(9)13(14,15)16/h3-7H,2H2,1H3 |
| InChIKey | PNZPKJCNXKAIDX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.13 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|