C21H18N4O3 — CID 71627496
ethyl 5-(1-benzyltriazol-4-yl)-3-phenyl-1,2-oxazole-4-carboxylate (PubChem CID 71627496) has the molecular formula C21H18N4O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is ethyl 5-(1-benzyltriazol-4-yl)-3-phenyl-1,2-oxazole-4-carboxylate.
| Compound Name | ethyl 5-(1-benzyltriazol-4-yl)-3-phenyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 71627496 |
| Molecular Formula | C21H18N4O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | ethyl 5-(1-benzyltriazol-4-yl)-3-phenyl-1,2-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)noc1-c1cn(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C21H18N4O3/c1-2-27-21(26)18-19(16-11-7-4-8-12-16)23-28-20(18)17-14-25(24-22-17)13-15-9-5-3-6-10-15/h3-12,14H,2,13H2,1H3 |
| InChIKey | NMHYCUBJFCVYGH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 83.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |