C13H13F2N3 — CID 103587997
5-(azetidin-3-yl)-1-(2,5-difluoro-4-methylphenyl)imidazole (PubChem CID 103587997) has the molecular formula C13H13F2N3 and a molecular weight of 249.26 g/mol. Its IUPAC name is 5-(azetidin-3-yl)-1-(2,5-difluoro-4-methylphenyl)imidazole.
| Compound Name | 5-(azetidin-3-yl)-1-(2,5-difluoro-4-methylphenyl)imidazole |
|---|---|
| PubChem CID | 103587997 |
| Molecular Formula | C13H13F2N3 |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 5-(azetidin-3-yl)-1-(2,5-difluoro-4-methylphenyl)imidazole |
| SMILES | Cc1cc(F)c(-n2cncc2C2CNC2)cc1F |
| InChI | InChI=1S/C13H13F2N3/c1-8-2-11(15)12(3-10(8)14)18-7-17-6-13(18)9-4-16-5-9/h2-3,6-7,9,16H,4-5H2,1H3 |
| InChIKey | FWZPIYBRNJJEAB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |