C13H12F3N3 — CID 114720008
5-pyrrolidin-3-yl-1-(2,4,5-trifluorophenyl)imidazole (PubChem CID 114720008) has the molecular formula C13H12F3N3 and a molecular weight of 267.25 g/mol. Its IUPAC name is 5-pyrrolidin-3-yl-1-(2,4,5-trifluorophenyl)imidazole.
| Compound Name | 5-pyrrolidin-3-yl-1-(2,4,5-trifluorophenyl)imidazole |
|---|---|
| PubChem CID | 114720008 |
| Molecular Formula | C13H12F3N3 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 5-pyrrolidin-3-yl-1-(2,4,5-trifluorophenyl)imidazole |
| SMILES | Fc1cc(F)c(-n2cncc2C2CCNC2)cc1F |
| InChI | InChI=1S/C13H12F3N3/c14-9-3-11(16)12(4-10(9)15)19-7-18-6-13(19)8-1-2-17-5-8/h3-4,6-8,17H,1-2,5H2 |
| InChIKey | LDAWQWOBVIOSLY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|