About 3-O-benzyl 5-O-ethyl 2,2-dimethyl-1,3-thiazolidine-3,5-dicarboxylate
3-O-benzyl 5-O-ethyl 2,2-dimethyl-1,3-thiazolidine-3,5-dicarboxylate (PubChem CID 10358838) has the molecular formula C16H21NO4S
and a molecular weight of 323.41 g/mol. Its IUPAC name is 3-O-benzyl 5-O-ethyl 2,2-dimethyl-1,3-thiazolidine-3,5-dicarboxylate.
Analyze 3-O-benzyl 5-O-ethyl 2,2-dimethyl-1,3-thiazolidine-3,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-benzyl 5-O-ethyl 2,2-dimethyl-1,3-thiazolidine-3,5-dicarboxylate?
The IUPAC name of 3-O-benzyl 5-O-ethyl 2,2-dimethyl-1,3-thiazolidine-3,5-dicarboxylate (CID 10358838) is 3-O-benzyl 5-O-ethyl 2,2-dimethyl-1,3-thiazolidine-3,5-dicarboxylate.
What is the SMILES notation for 3-O-benzyl 5-O-ethyl 2,2-dimethyl-1,3-thiazolidine-3,5-dicarboxylate?
The canonical SMILES for 3-O-benzyl 5-O-ethyl 2,2-dimethyl-1,3-thiazolidine-3,5-dicarboxylate is CCOC(=O)C1CN(C(=O)OCc2ccccc2)C(C)(C)S1.
What is the InChIKey of 3-O-benzyl 5-O-ethyl 2,2-dimethyl-1,3-thiazolidine-3,5-dicarboxylate?
The InChIKey is IYDOMNTZXVYFAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO4S/c1-4-20-14(18)13-10-17(16(2,3)22-13)15(19)21-11-12-8-6-5-7-9-12/h5-9,13H,4,10-11H2,1-3H3.
What are the key properties of 3-O-benzyl 5-O-ethyl 2,2-dimethyl-1,3-thiazolidine-3,5-dicarboxylate?
3-O-benzyl 5-O-ethyl 2,2-dimethyl-1,3-thiazolidine-3,5-dicarboxylate has a molecular weight of 323.41 g/mol, XLogP of 3.04, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-benzyl 5-O-ethyl 2,2-dimethyl-1,3-thiazolidine-3,5-dicarboxylate is sourced from PubChem (CID 10358838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).