C16H19NO2S2 — CID 11823417
benzyl 2-(1,3-dithian-2-ylidene)pyrrolidine-1-carboxylate (PubChem CID 11823417) has the molecular formula C16H19NO2S2 and a molecular weight of 321.47 g/mol. Its IUPAC name is benzyl 2-(1,3-dithian-2-ylidene)pyrrolidine-1-carboxylate.
| Compound Name | benzyl 2-(1,3-dithian-2-ylidene)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11823417 |
| Molecular Formula | C16H19NO2S2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | benzyl 2-(1,3-dithian-2-ylidene)pyrrolidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCCC1=C1SCCCS1 |
| InChI | InChI=1S/C16H19NO2S2/c18-16(19-12-13-6-2-1-3-7-13)17-9-4-8-14(17)15-20-10-5-11-21-15/h1-3,6-7H,4-5,8-12H2 |
| InChIKey | GRMJPCUIINEDRZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |