benzyl 3-methylsulfanylcarbonylpyrrolidine-1-carboxylate

C14H17NO3S — CID 168654785

IUPACbenzyl 3-methylsulfanylcarbonylpyrrolidine-1-carboxylate
SMILESCSC(=O)C1CCN(C(=O)OCc2ccccc2)C1
InChIInChI=1S/C14H17NO3S/c1-19-13(16)12-7-8-15(9-12)14(17)18-10-11-5-3-2-4-6-11/h2-6,12H,7-10H2,1H3
InChIKeyQOERLMZABJLUHZ-UHFFFAOYSA-N
MW279.36 g/mol
LogP2.53
Rot. Bonds3

About benzyl 3-methylsulfanylcarbonylpyrrolidine-1-carboxylate

benzyl 3-methylsulfanylcarbonylpyrrolidine-1-carboxylate (PubChem CID 168654785) has the molecular formula C14H17NO3S and a molecular weight of 279.36 g/mol. Its IUPAC name is benzyl 3-methylsulfanylcarbonylpyrrolidine-1-carboxylate.

Molecular Properties

Compound Namebenzyl 3-methylsulfanylcarbonylpyrrolidine-1-carboxylate
PubChem CID168654785
Molecular FormulaC14H17NO3S
Molecular Weight279.36 g/mol
Exact Mass279.09
IUPAC Namebenzyl 3-methylsulfanylcarbonylpyrrolidine-1-carboxylate
SMILESCSC(=O)C1CCN(C(=O)OCc2ccccc2)C1
InChIInChI=1S/C14H17NO3S/c1-19-13(16)12-7-8-15(9-12)14(17)18-10-11-5-3-2-4-6-11/h2-6,12H,7-10H2,1H3
InChIKeyQOERLMZABJLUHZ-UHFFFAOYSA-N
XLogP2.53
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.36
LogP ≤ 52.53
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thioester', 'substructure': 'N/A'}

Analyze benzyl 3-methylsulfanylcarbonylpyrrolidine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 3-methylsulfanylcarbonylpyrrolidine-1-carboxylate?
The IUPAC name of benzyl 3-methylsulfanylcarbonylpyrrolidine-1-carboxylate (CID 168654785) is benzyl 3-methylsulfanylcarbonylpyrrolidine-1-carboxylate.
What is the SMILES notation for benzyl 3-methylsulfanylcarbonylpyrrolidine-1-carboxylate?
The canonical SMILES for benzyl 3-methylsulfanylcarbonylpyrrolidine-1-carboxylate is CSC(=O)C1CCN(C(=O)OCc2ccccc2)C1.
What is the InChIKey of benzyl 3-methylsulfanylcarbonylpyrrolidine-1-carboxylate?
The InChIKey is QOERLMZABJLUHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO3S/c1-19-13(16)12-7-8-15(9-12)14(17)18-10-11-5-3-2-4-6-11/h2-6,12H,7-10H2,1H3.
What are the key properties of benzyl 3-methylsulfanylcarbonylpyrrolidine-1-carboxylate?
benzyl 3-methylsulfanylcarbonylpyrrolidine-1-carboxylate has a molecular weight of 279.36 g/mol, XLogP of 2.53, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-methylsulfanylcarbonylpyrrolidine-1-carboxylate is sourced from PubChem (CID 168654785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).