C16H21NO3S2 — CID 135050468
benzyl 2-(3-sulfanylpropylsulfanylcarbonyl)pyrrolidine-1-carboxylate (PubChem CID 135050468) has the molecular formula C16H21NO3S2 and a molecular weight of 339.48 g/mol. Its IUPAC name is benzyl 2-(3-sulfanylpropylsulfanylcarbonyl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl 2-(3-sulfanylpropylsulfanylcarbonyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 135050468 |
| Molecular Formula | C16H21NO3S2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | benzyl 2-(3-sulfanylpropylsulfanylcarbonyl)pyrrolidine-1-carboxylate |
| SMILES | O=C(SCCCS)C1CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H21NO3S2/c18-15(22-11-5-10-21)14-8-4-9-17(14)16(19)20-12-13-6-2-1-3-7-13/h1-3,6-7,14,21H,4-5,8-12H2 |
| InChIKey | CNZYIAQXLQJLPV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|