C12H13BrN2O3 — CID 103588643
4-(3-bromo-5-nitrophenoxy)-2,2-dimethylbutanenitrile (PubChem CID 103588643) has the molecular formula C12H13BrN2O3 and a molecular weight of 313.15 g/mol. Its IUPAC name is 4-(3-bromo-5-nitrophenoxy)-2,2-dimethylbutanenitrile.
| Compound Name | 4-(3-bromo-5-nitrophenoxy)-2,2-dimethylbutanenitrile |
|---|---|
| PubChem CID | 103588643 |
| Molecular Formula | C12H13BrN2O3 |
| Molecular Weight | 313.15 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 4-(3-bromo-5-nitrophenoxy)-2,2-dimethylbutanenitrile |
| SMILES | CC(C)(C#N)CCOc1cc(Br)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H13BrN2O3/c1-12(2,8-14)3-4-18-11-6-9(13)5-10(7-11)15(16)17/h5-7H,3-4H2,1-2H3 |
| InChIKey | JZICJBVBKOOVMR-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 76.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.15 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|