C14H16BrN3O3 — CID 103589345
3-(3-bromo-5-nitrophenoxy)-1-(ethylamino)cyclopentane-1-carbonitrile (PubChem CID 103589345) has the molecular formula C14H16BrN3O3 and a molecular weight of 354.20 g/mol. Its IUPAC name is 3-(3-bromo-5-nitrophenoxy)-1-(ethylamino)cyclopentane-1-carbonitrile.
| Compound Name | 3-(3-bromo-5-nitrophenoxy)-1-(ethylamino)cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 103589345 |
| Molecular Formula | C14H16BrN3O3 |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 3-(3-bromo-5-nitrophenoxy)-1-(ethylamino)cyclopentane-1-carbonitrile |
| SMILES | CCNC1(C#N)CCC(Oc2cc(Br)cc([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C14H16BrN3O3/c1-2-17-14(9-16)4-3-12(8-14)21-13-6-10(15)5-11(7-13)18(19)20/h5-7,12,17H,2-4,8H2,1H3 |
| InChIKey | VDBGXPJNIHXBSZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 88.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|