C12H13FN2O — CID 103589771
4-fluoro-1-N-(furan-2-ylmethyl)-5-methylbenzene-1,2-diamine (PubChem CID 103589771) has the molecular formula C12H13FN2O and a molecular weight of 220.25 g/mol. Its IUPAC name is 4-fluoro-1-N-(furan-2-ylmethyl)-5-methylbenzene-1,2-diamine.
| Compound Name | 4-fluoro-1-N-(furan-2-ylmethyl)-5-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 103589771 |
| Molecular Formula | C12H13FN2O |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 4-fluoro-1-N-(furan-2-ylmethyl)-5-methylbenzene-1,2-diamine |
| SMILES | Cc1cc(NCc2ccco2)c(N)cc1F |
| InChI | InChI=1S/C12H13FN2O/c1-8-5-12(11(14)6-10(8)13)15-7-9-3-2-4-16-9/h2-6,15H,7,14H2,1H3 |
| InChIKey | GEVJDOKFYPFSSW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|