C13H19FN2 — CID 103590389
4-fluoro-5-methyl-1-N-(2-methylcyclopentyl)benzene-1,2-diamine (PubChem CID 103590389) has the molecular formula C13H19FN2 and a molecular weight of 222.31 g/mol. Its IUPAC name is 4-fluoro-5-methyl-1-N-(2-methylcyclopentyl)benzene-1,2-diamine.
| Compound Name | 4-fluoro-5-methyl-1-N-(2-methylcyclopentyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 103590389 |
| Molecular Formula | C13H19FN2 |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 4-fluoro-5-methyl-1-N-(2-methylcyclopentyl)benzene-1,2-diamine |
| SMILES | Cc1cc(NC2CCCC2C)c(N)cc1F |
| InChI | InChI=1S/C13H19FN2/c1-8-4-3-5-12(8)16-13-6-9(2)10(14)7-11(13)15/h6-8,12,16H,3-5,15H2,1-2H3 |
| InChIKey | FUTFSBWTURYQJF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|