C13H19FN2S — CID 114121281
4-fluoro-5-methyl-1-N-(2-methylsulfanylcyclopentyl)benzene-1,2-diamine (PubChem CID 114121281) has the molecular formula C13H19FN2S and a molecular weight of 254.37 g/mol. Its IUPAC name is 4-fluoro-5-methyl-1-N-(2-methylsulfanylcyclopentyl)benzene-1,2-diamine.
| Compound Name | 4-fluoro-5-methyl-1-N-(2-methylsulfanylcyclopentyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 114121281 |
| Molecular Formula | C13H19FN2S |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 4-fluoro-5-methyl-1-N-(2-methylsulfanylcyclopentyl)benzene-1,2-diamine |
| SMILES | CSC1CCCC1Nc1cc(C)c(F)cc1N |
| InChI | InChI=1S/C13H19FN2S/c1-8-6-12(10(15)7-9(8)14)16-11-4-3-5-13(11)17-2/h6-7,11,13,16H,3-5,15H2,1-2H3 |
| InChIKey | HXDISARXDDYWQL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|