C14H22N2S — CID 114122381
2-methyl-3-N-(2-methylsulfanylcyclohexyl)benzene-1,3-diamine (PubChem CID 114122381) has the molecular formula C14H22N2S and a molecular weight of 250.41 g/mol. Its IUPAC name is 2-methyl-3-N-(2-methylsulfanylcyclohexyl)benzene-1,3-diamine.
| Compound Name | 2-methyl-3-N-(2-methylsulfanylcyclohexyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 114122381 |
| Molecular Formula | C14H22N2S |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 2-methyl-3-N-(2-methylsulfanylcyclohexyl)benzene-1,3-diamine |
| SMILES | CSC1CCCCC1Nc1cccc(N)c1C |
| InChI | InChI=1S/C14H22N2S/c1-10-11(15)6-5-8-12(10)16-13-7-3-4-9-14(13)17-2/h5-6,8,13-14,16H,3-4,7,9,15H2,1-2H3 |
| InChIKey | NOOZGYVICNCOEU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|