C12H17N3O2S — CID 114121297
1-N-(2-methylsulfanylcyclopentyl)-4-nitrobenzene-1,2-diamine (PubChem CID 114121297) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is 1-N-(2-methylsulfanylcyclopentyl)-4-nitrobenzene-1,2-diamine.
| Compound Name | 1-N-(2-methylsulfanylcyclopentyl)-4-nitrobenzene-1,2-diamine |
|---|---|
| PubChem CID | 114121297 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 1-N-(2-methylsulfanylcyclopentyl)-4-nitrobenzene-1,2-diamine |
| SMILES | CSC1CCCC1Nc1ccc([N+](=O)[O-])cc1N |
| InChI | InChI=1S/C12H17N3O2S/c1-18-12-4-2-3-11(12)14-10-6-5-8(15(16)17)7-9(10)13/h5-7,11-12,14H,2-4,13H2,1H3 |
| InChIKey | UCNDQLWDZXDAJK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|