About 3,5-difluoro-2-N-methyl-6-N-(2-methylsulfanylcyclopentyl)pyridine-2,6-diamine
3,5-difluoro-2-N-methyl-6-N-(2-methylsulfanylcyclopentyl)pyridine-2,6-diamine (PubChem CID 114122146) has the molecular formula C12H17F2N3S
and a molecular weight of 273.35 g/mol. Its IUPAC name is 3,5-difluoro-2-N-methyl-6-N-(2-methylsulfanylcyclopentyl)pyridine-2,6-diamine.
Molecular Properties
| Compound Name | 3,5-difluoro-2-N-methyl-6-N-(2-methylsulfanylcyclopentyl)pyridine-2,6-diamine |
| PubChem CID | 114122146 |
| Molecular Formula | C12H17F2N3S |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 3,5-difluoro-2-N-methyl-6-N-(2-methylsulfanylcyclopentyl)pyridine-2,6-diamine |
| SMILES | CNc1nc(NC2CCCC2SC)c(F)cc1F |
| InChI | InChI=1S/C12H17F2N3S/c1-15-11-7(13)6-8(14)12(17-11)16-9-4-3-5-10(9)18-2/h6,9-10H,3-5H2,1-2H3,(H2,15,16,17) |
| InChIKey | KPVJKRQIBPYUIB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,5-difluoro-2-N-methyl-6-N-(2-methylsulfanylcyclopentyl)pyridine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-difluoro-2-N-methyl-6-N-(2-methylsulfanylcyclopentyl)pyridine-2,6-diamine?
The IUPAC name of 3,5-difluoro-2-N-methyl-6-N-(2-methylsulfanylcyclopentyl)pyridine-2,6-diamine (CID 114122146) is 3,5-difluoro-2-N-methyl-6-N-(2-methylsulfanylcyclopentyl)pyridine-2,6-diamine.
What is the SMILES notation for 3,5-difluoro-2-N-methyl-6-N-(2-methylsulfanylcyclopentyl)pyridine-2,6-diamine?
The canonical SMILES for 3,5-difluoro-2-N-methyl-6-N-(2-methylsulfanylcyclopentyl)pyridine-2,6-diamine is CNc1nc(NC2CCCC2SC)c(F)cc1F.
What is the InChIKey of 3,5-difluoro-2-N-methyl-6-N-(2-methylsulfanylcyclopentyl)pyridine-2,6-diamine?
The InChIKey is KPVJKRQIBPYUIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F2N3S/c1-15-11-7(13)6-8(14)12(17-11)16-9-4-3-5-10(9)18-2/h6,9-10H,3-5H2,1-2H3,(H2,15,16,17).
What are the key properties of 3,5-difluoro-2-N-methyl-6-N-(2-methylsulfanylcyclopentyl)pyridine-2,6-diamine?
3,5-difluoro-2-N-methyl-6-N-(2-methylsulfanylcyclopentyl)pyridine-2,6-diamine has a molecular weight of 273.35 g/mol, XLogP of 3.10, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-difluoro-2-N-methyl-6-N-(2-methylsulfanylcyclopentyl)pyridine-2,6-diamine is sourced from PubChem (CID 114122146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).