C18H34O3Si — CID 10359041
[(2R,4aR,6R,9aS)-2-ethenyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrano[3,2-b]oxepin-6-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 10359041) has the molecular formula C18H34O3Si and a molecular weight of 326.55 g/mol. Its IUPAC name is [(2R,4aR,6R,9aS)-2-ethenyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrano[3,2-b]oxepin-6-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,4aR,6R,9aS)-2-ethenyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrano[3,2-b]oxepin-6-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10359041 |
| Molecular Formula | C18H34O3Si |
| Molecular Weight | 326.55 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | [(2R,4aR,6R,9aS)-2-ethenyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrano[3,2-b]oxepin-6-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | C=C[C@H]1CC[C@H]2O[C@@H](CO[Si](C)(C)C(C)(C)C)CCC[C@@H]2O1 |
| InChI | InChI=1S/C18H34O3Si/c1-7-14-11-12-17-16(20-14)10-8-9-15(21-17)13-19-22(5,6)18(2,3)4/h7,14-17H,1,8-13H2,2-6H3/t14-,15+,16-,17+/m0/s1 |
| InChIKey | SDHUDTZNUIFIOM-VVLHAWIVSA-N |
| XLogP | 4.68 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.55 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|