C14H24O3Si — CID 11448573
(1R,3S,8R,11S)-13,13-dimethyl-2,7,12-trioxa-13-silatricyclo[9.5.0.03,8]hexadec-15-ene (PubChem CID 11448573) has the molecular formula C14H24O3Si and a molecular weight of 268.43 g/mol. Its IUPAC name is (1R,3S,8R,11S)-13,13-dimethyl-2,7,12-trioxa-13-silatricyclo[9.5.0.03,8]hexadec-15-ene.
| Compound Name | (1R,3S,8R,11S)-13,13-dimethyl-2,7,12-trioxa-13-silatricyclo[9.5.0.03,8]hexadec-15-ene |
|---|---|
| PubChem CID | 11448573 |
| Molecular Formula | C14H24O3Si |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | (1R,3S,8R,11S)-13,13-dimethyl-2,7,12-trioxa-13-silatricyclo[9.5.0.03,8]hexadec-15-ene |
| SMILES | C[Si]1(C)CC=C[C@H]2O[C@H]3CCCO[C@@H]3CC[C@@H]2O1 |
| InChI | InChI=1S/C14H24O3Si/c1-18(2)10-4-6-13-14(17-18)8-7-11-12(16-13)5-3-9-15-11/h4,6,11-14H,3,5,7-10H2,1-2H3/t11-,12+,13-,14+/m1/s1 |
| InChIKey | FBHJYFOILDFFPK-RQJABVFESA-N |
| XLogP | 2.87 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|