C25H46O5Si2 — CID 10972909
(1S,3R,8S,10R,11R)-10-[(1E)-buta-1,3-dienyl]-13,13,15,15-tetra(propan-2-yl)-4,9,12,14,16-pentaoxa-13,15-disilatricyclo[9.5.0.03,8]hexadecane (PubChem CID 10972909) has the molecular formula C25H46O5Si2 and a molecular weight of 482.81 g/mol. Its IUPAC name is (1S,3R,8S,10R,11R)-10-[(1E)-buta-1,3-dienyl]-13,13,15,15-tetra(propan-2-yl)-4,9,12,14,16-pentaoxa-13,15-disilatricyclo[9.5.0.03,8]hexadecane.
| Compound Name | (1S,3R,8S,10R,11R)-10-[(1E)-buta-1,3-dienyl]-13,13,15,15-tetra(propan-2-yl)-4,9,12,14,16-pentaoxa-13,15-disilatricyclo[9.5.0.03,8]hexadecane |
|---|---|
| PubChem CID | 10972909 |
| Molecular Formula | C25H46O5Si2 |
| Molecular Weight | 482.81 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | (1S,3R,8S,10R,11R)-10-[(1E)-buta-1,3-dienyl]-13,13,15,15-tetra(propan-2-yl)-4,9,12,14,16-pentaoxa-13,15-disilatricyclo[9.5.0.03,8]hexadecane |
| SMILES | C=C/C=C/[C@H]1O[C@H]2CCCO[C@@H]2C[C@@H]2O[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)O[C@@H]21 |
| InChI | InChI=1S/C25H46O5Si2/c1-10-11-13-22-25-24(16-23-21(27-22)14-12-15-26-23)28-31(17(2)3,18(4)5)30-32(29-25,19(6)7)20(8)9/h10-11,13,17-25H,1,12,14-16H2,2-9H3/b13-11+/t21-,22+,23+,24-,25+/m0/s1 |
| InChIKey | CNPMKTBAJMXZQE-ILODZLBHSA-N |
| XLogP | 6.39 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.81 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|