C24H40O5Si2 — CID 11328767
(1S,3R,6S,12R,14S,17R,19S,25R)-8,8,23,23-tetramethyl-2,7,13,18,24-pentaoxa-8,23-disilapentacyclo[15.10.0.03,14.06,12.019,25]heptacosa-10,20-diene (PubChem CID 11328767) has the molecular formula C24H40O5Si2 and a molecular weight of 464.75 g/mol. Its IUPAC name is (1S,3R,6S,12R,14S,17R,19S,25R)-8,8,23,23-tetramethyl-2,7,13,18,24-pentaoxa-8,23-disilapentacyclo[15.10.0.03,14.06,12.019,25]heptacosa-10,20-diene.
| Compound Name | (1S,3R,6S,12R,14S,17R,19S,25R)-8,8,23,23-tetramethyl-2,7,13,18,24-pentaoxa-8,23-disilapentacyclo[15.10.0.03,14.06,12.019,25]heptacosa-10,20-diene |
|---|---|
| PubChem CID | 11328767 |
| Molecular Formula | C24H40O5Si2 |
| Molecular Weight | 464.75 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | (1S,3R,6S,12R,14S,17R,19S,25R)-8,8,23,23-tetramethyl-2,7,13,18,24-pentaoxa-8,23-disilapentacyclo[15.10.0.03,14.06,12.019,25]heptacosa-10,20-diene |
| SMILES | C[Si]1(C)CC=C[C@H]2O[C@H]3CC[C@H]4O[C@H]5C=CC[Si](C)(C)O[C@@H]5CC[C@@H]4O[C@@H]3CC[C@@H]2O1 |
| InChI | InChI=1S/C24H40O5Si2/c1-30(2)15-5-7-17-23(28-30)13-11-21-19(25-17)9-10-20-22(27-21)12-14-24-18(26-20)8-6-16-31(3,4)29-24/h5-8,17-24H,9-16H2,1-4H3/t17-,18+,19+,20-,21-,22+,23+,24- |
| InChIKey | HVWGPBZPCAKDGB-VKFXDHOHSA-N |
| XLogP | 4.95 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.75 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|