C10H18O2Si — CID 11458284
(5aR,9aS)-2,2-dimethyl-3,5a,7,8,9,9a-hexahydropyrano[2,3-f]oxasilepine (PubChem CID 11458284) has the molecular formula C10H18O2Si and a molecular weight of 198.34 g/mol. Its IUPAC name is (5aR,9aS)-2,2-dimethyl-3,5a,7,8,9,9a-hexahydropyrano[2,3-f]oxasilepine.
| Compound Name | (5aR,9aS)-2,2-dimethyl-3,5a,7,8,9,9a-hexahydropyrano[2,3-f]oxasilepine |
|---|---|
| PubChem CID | 11458284 |
| Molecular Formula | C10H18O2Si |
| Molecular Weight | 198.34 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | (5aR,9aS)-2,2-dimethyl-3,5a,7,8,9,9a-hexahydropyrano[2,3-f]oxasilepine |
| SMILES | C[Si]1(C)CC=C[C@H]2OCCC[C@@H]2O1 |
| InChI | InChI=1S/C10H18O2Si/c1-13(2)8-4-6-9-10(12-13)5-3-7-11-9/h4,6,9-10H,3,5,7-8H2,1-2H3/t9-,10+/m1/s1 |
| InChIKey | UGHHMMGXGQANCY-ZJUUUORDSA-N |
| XLogP | 2.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|