C9H16O2Si — CID 134889932
trimethyl-[[(1S,6S)-7-oxabicyclo[4.1.0]hept-2-en-2-yl]oxy]silane (PubChem CID 134889932) has the molecular formula C9H16O2Si and a molecular weight of 184.31 g/mol. Its IUPAC name is trimethyl-[[(1S,6S)-7-oxabicyclo[4.1.0]hept-2-en-2-yl]oxy]silane.
| Compound Name | trimethyl-[[(1S,6S)-7-oxabicyclo[4.1.0]hept-2-en-2-yl]oxy]silane |
|---|---|
| PubChem CID | 134889932 |
| Molecular Formula | C9H16O2Si |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | trimethyl-[[(1S,6S)-7-oxabicyclo[4.1.0]hept-2-en-2-yl]oxy]silane |
| SMILES | C[Si](C)(C)OC1=CCC[C@@H]2O[C@H]12 |
| InChI | InChI=1S/C9H16O2Si/c1-12(2,3)11-8-6-4-5-7-9(8)10-7/h6-7,9H,4-5H2,1-3H3/t7-,9-/m0/s1 |
| InChIKey | BEBDSDFTBRVUDI-CBAPKCEASA-N |
| XLogP | 2.28 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|