C10H18O2Si — CID 134889954
trimethyl-[[(1S,6S)-6-methyl-7-oxabicyclo[4.1.0]hept-2-en-2-yl]oxy]silane (PubChem CID 134889954) has the molecular formula C10H18O2Si and a molecular weight of 198.34 g/mol. Its IUPAC name is trimethyl-[[(1S,6S)-6-methyl-7-oxabicyclo[4.1.0]hept-2-en-2-yl]oxy]silane.
| Compound Name | trimethyl-[[(1S,6S)-6-methyl-7-oxabicyclo[4.1.0]hept-2-en-2-yl]oxy]silane |
|---|---|
| PubChem CID | 134889954 |
| Molecular Formula | C10H18O2Si |
| Molecular Weight | 198.34 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | trimethyl-[[(1S,6S)-6-methyl-7-oxabicyclo[4.1.0]hept-2-en-2-yl]oxy]silane |
| SMILES | C[C@]12CCC=C(O[Si](C)(C)C)[C@H]1O2 |
| InChI | InChI=1S/C10H18O2Si/c1-10-7-5-6-8(9(10)11-10)12-13(2,3)4/h6,9H,5,7H2,1-4H3/t9-,10+/m1/s1 |
| InChIKey | CQCFPIIXARNTTA-ZJUUUORDSA-N |
| XLogP | 2.67 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|