C15H28O2Si — CID 139263634
[(1S,4R,5S)-4-butyl-6-oxabicyclo[3.1.0]hex-2-en-2-yl]oxy-triethylsilane (PubChem CID 139263634) has the molecular formula C15H28O2Si and a molecular weight of 268.47 g/mol. Its IUPAC name is [(1S,4R,5S)-4-butyl-6-oxabicyclo[3.1.0]hex-2-en-2-yl]oxy-triethylsilane.
| Compound Name | [(1S,4R,5S)-4-butyl-6-oxabicyclo[3.1.0]hex-2-en-2-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 139263634 |
| Molecular Formula | C15H28O2Si |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | [(1S,4R,5S)-4-butyl-6-oxabicyclo[3.1.0]hex-2-en-2-yl]oxy-triethylsilane |
| SMILES | CCCC[C@@H]1C=C(O[Si](CC)(CC)CC)[C@H]2O[C@H]21 |
| InChI | InChI=1S/C15H28O2Si/c1-5-9-10-12-11-13(15-14(12)16-15)17-18(6-2,7-3)8-4/h11-12,14-15H,5-10H2,1-4H3/t12-,14+,15-/m1/s1 |
| InChIKey | JOTSDPGLAAGFTN-VHDGCEQUSA-N |
| XLogP | 4.48 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|