C13H22O2Si — CID 139263636
[(1S,4R,5S)-4-ethenyl-6-oxabicyclo[3.1.0]hex-2-en-2-yl]oxy-triethylsilane (PubChem CID 139263636) has the molecular formula C13H22O2Si and a molecular weight of 238.40 g/mol. Its IUPAC name is [(1S,4R,5S)-4-ethenyl-6-oxabicyclo[3.1.0]hex-2-en-2-yl]oxy-triethylsilane.
| Compound Name | [(1S,4R,5S)-4-ethenyl-6-oxabicyclo[3.1.0]hex-2-en-2-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 139263636 |
| Molecular Formula | C13H22O2Si |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | [(1S,4R,5S)-4-ethenyl-6-oxabicyclo[3.1.0]hex-2-en-2-yl]oxy-triethylsilane |
| SMILES | C=C[C@@H]1C=C(O[Si](CC)(CC)CC)[C@H]2O[C@@H]12 |
| InChI | InChI=1S/C13H22O2Si/c1-5-10-9-11(13-12(10)14-13)15-16(6-2,7-3)8-4/h5,9-10,12-13H,1,6-8H2,2-4H3/t10-,12+,13-/m1/s1 |
| InChIKey | IIJCSAOGKONPPW-KGYLQXTDSA-N |
| XLogP | 3.48 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|