C7H9LiO2 — CID 134890094
lithium (1R,6S)-6-methyl-7-oxabicyclo[4.1.0]hept-2-en-2-olate (PubChem CID 134890094) has the molecular formula C7H9LiO2 and a molecular weight of 132.09 g/mol. Its IUPAC name is lithium (1R,6S)-6-methyl-7-oxabicyclo[4.1.0]hept-2-en-2-olate.
| Compound Name | lithium (1R,6S)-6-methyl-7-oxabicyclo[4.1.0]hept-2-en-2-olate |
|---|---|
| PubChem CID | 134890094 |
| Molecular Formula | C7H9LiO2 |
| Molecular Weight | 132.09 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | lithium (1R,6S)-6-methyl-7-oxabicyclo[4.1.0]hept-2-en-2-olate |
| SMILES | C[C@]12CCC=C([O-])[C@H]1O2.[Li+] |
| InChI | InChI=1S/C7H10O2.Li/c1-7-4-2-3-5(8)6(7)9-7;/h3,6,8H,2,4H2,1H3;/q;+1/p-1/t6-,7+;/m1./s1 |
| InChIKey | ZXGRVSZOHYRTHL-HHQFNNIRSA-M |
| XLogP | -2.81 |
| TPSA | 35.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.09 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|