C8H10O2 — CID 141119726
4-ethyl-3,8-dioxatricyclo[5.1.0.02,4]oct-5-ene (PubChem CID 141119726) has the molecular formula C8H10O2 and a molecular weight of 138.17 g/mol. Its IUPAC name is 4-ethyl-3,8-dioxatricyclo[5.1.0.02,4]oct-5-ene.
| Compound Name | 4-ethyl-3,8-dioxatricyclo[5.1.0.02,4]oct-5-ene |
|---|---|
| PubChem CID | 141119726 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | 4-ethyl-3,8-dioxatricyclo[5.1.0.02,4]oct-5-ene |
| SMILES | CCC12C=CC3OC3C1O2 |
| InChI | InChI=1S/C8H10O2/c1-2-8-4-3-5-6(9-5)7(8)10-8/h3-7H,2H2,1H3 |
| InChIKey | OVYWYTAPYGXZHD-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|