C16H23F2N3O2 — CID 10359067
(3R)-3-amino-4-cyclohexyl-N-(2,4-difluorophenyl)-2-hydroxybutanehydrazide (PubChem CID 10359067) has the molecular formula C16H23F2N3O2 and a molecular weight of 327.38 g/mol. Its IUPAC name is (3R)-3-amino-4-cyclohexyl-N-(2,4-difluorophenyl)-2-hydroxybutanehydrazide.
| Compound Name | (3R)-3-amino-4-cyclohexyl-N-(2,4-difluorophenyl)-2-hydroxybutanehydrazide |
|---|---|
| PubChem CID | 10359067 |
| Molecular Formula | C16H23F2N3O2 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | (3R)-3-amino-4-cyclohexyl-N-(2,4-difluorophenyl)-2-hydroxybutanehydrazide |
| SMILES | N[C@H](CC1CCCCC1)C(O)C(=O)N(N)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H23F2N3O2/c17-11-6-7-14(12(18)9-11)21(20)16(23)15(22)13(19)8-10-4-2-1-3-5-10/h6-7,9-10,13,15,22H,1-5,8,19-20H2/t13-,15?/m1/s1 |
| InChIKey | PVIIONNLLJVNTK-AFYYWNPRSA-N |
| XLogP | 1.83 |
| TPSA | 92.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|