C15H12BrFN2S — CID 103592038
3-(2-bromo-4-methylphenyl)-6-fluoro-5-methyl-1H-benzimidazole-2-thione (PubChem CID 103592038) has the molecular formula C15H12BrFN2S and a molecular weight of 351.24 g/mol. Its IUPAC name is 3-(2-bromo-4-methylphenyl)-6-fluoro-5-methyl-1H-benzimidazole-2-thione.
| Compound Name | 3-(2-bromo-4-methylphenyl)-6-fluoro-5-methyl-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 103592038 |
| Molecular Formula | C15H12BrFN2S |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | 3-(2-bromo-4-methylphenyl)-6-fluoro-5-methyl-1H-benzimidazole-2-thione |
| SMILES | Cc1ccc(-n2c(=S)[nH]c3cc(F)c(C)cc32)c(Br)c1 |
| InChI | InChI=1S/C15H12BrFN2S/c1-8-3-4-13(10(16)5-8)19-14-6-9(2)11(17)7-12(14)18-15(19)20/h3-7H,1-2H3,(H,18,20) |
| InChIKey | FCEHLZGNOLFCAO-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|