C14H8BrF3N2S — CID 107613783
3-(4-bromo-2,5-difluorophenyl)-6-fluoro-5-methyl-1H-benzimidazole-2-thione (PubChem CID 107613783) has the molecular formula C14H8BrF3N2S and a molecular weight of 373.20 g/mol. Its IUPAC name is 3-(4-bromo-2,5-difluorophenyl)-6-fluoro-5-methyl-1H-benzimidazole-2-thione.
| Compound Name | 3-(4-bromo-2,5-difluorophenyl)-6-fluoro-5-methyl-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 107613783 |
| Molecular Formula | C14H8BrF3N2S |
| Molecular Weight | 373.20 g/mol |
| Exact Mass | 371.95 |
| IUPAC Name | 3-(4-bromo-2,5-difluorophenyl)-6-fluoro-5-methyl-1H-benzimidazole-2-thione |
| SMILES | Cc1cc2c(cc1F)[nH]c(=S)n2-c1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C14H8BrF3N2S/c1-6-2-13-11(4-8(6)16)19-14(21)20(13)12-5-9(17)7(15)3-10(12)18/h2-5H,1H3,(H,19,21) |
| InChIKey | PCQYZPMGLOMSPD-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.20 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|