C13H6BrF3N2S — CID 107613775
3-(4-bromo-2,5-difluorophenyl)-6-fluoro-1H-benzimidazole-2-thione (PubChem CID 107613775) has the molecular formula C13H6BrF3N2S and a molecular weight of 359.17 g/mol. Its IUPAC name is 3-(4-bromo-2,5-difluorophenyl)-6-fluoro-1H-benzimidazole-2-thione.
| Compound Name | 3-(4-bromo-2,5-difluorophenyl)-6-fluoro-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 107613775 |
| Molecular Formula | C13H6BrF3N2S |
| Molecular Weight | 359.17 g/mol |
| Exact Mass | 357.94 |
| IUPAC Name | 3-(4-bromo-2,5-difluorophenyl)-6-fluoro-1H-benzimidazole-2-thione |
| SMILES | Fc1ccc2c(c1)[nH]c(=S)n2-c1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C13H6BrF3N2S/c14-7-4-9(17)12(5-8(7)16)19-11-2-1-6(15)3-10(11)18-13(19)20/h1-5H,(H,18,20) |
| InChIKey | NPRQZFXXBTVYMP-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.17 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|