C13H6F3IN2S — CID 66080924
6-iodo-3-(2,4,5-trifluorophenyl)-1H-benzimidazole-2-thione (PubChem CID 66080924) has the molecular formula C13H6F3IN2S and a molecular weight of 406.17 g/mol. Its IUPAC name is 6-iodo-3-(2,4,5-trifluorophenyl)-1H-benzimidazole-2-thione.
| Compound Name | 6-iodo-3-(2,4,5-trifluorophenyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 66080924 |
| Molecular Formula | C13H6F3IN2S |
| Molecular Weight | 406.17 g/mol |
| Exact Mass | 405.92 |
| IUPAC Name | 6-iodo-3-(2,4,5-trifluorophenyl)-1H-benzimidazole-2-thione |
| SMILES | Fc1cc(F)c(-n2c(=S)[nH]c3cc(I)ccc32)cc1F |
| InChI | InChI=1S/C13H6F3IN2S/c14-7-4-9(16)12(5-8(7)15)19-11-2-1-6(17)3-10(11)18-13(19)20/h1-5H,(H,18,20) |
| InChIKey | KDOFKDSLMJXZIZ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.17 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|