C14H9Cl2IN2S — CID 104727527
3-(2,5-dichloro-4-methylphenyl)-6-iodo-1H-benzimidazole-2-thione (PubChem CID 104727527) has the molecular formula C14H9Cl2IN2S and a molecular weight of 435.12 g/mol. Its IUPAC name is 3-(2,5-dichloro-4-methylphenyl)-6-iodo-1H-benzimidazole-2-thione.
| Compound Name | 3-(2,5-dichloro-4-methylphenyl)-6-iodo-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 104727527 |
| Molecular Formula | C14H9Cl2IN2S |
| Molecular Weight | 435.12 g/mol |
| Exact Mass | 433.89 |
| IUPAC Name | 3-(2,5-dichloro-4-methylphenyl)-6-iodo-1H-benzimidazole-2-thione |
| SMILES | Cc1cc(Cl)c(-n2c(=S)[nH]c3cc(I)ccc32)cc1Cl |
| InChI | InChI=1S/C14H9Cl2IN2S/c1-7-4-10(16)13(6-9(7)15)19-12-3-2-8(17)5-11(12)18-14(19)20/h2-6H,1H3,(H,18,20) |
| InChIKey | PKXPUAVMUPETAE-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.12 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|