C13H13FN4S — CID 103592537
3-(1,3-dimethylpyrazol-4-yl)-6-fluoro-5-methyl-1H-benzimidazole-2-thione (PubChem CID 103592537) has the molecular formula C13H13FN4S and a molecular weight of 276.34 g/mol. Its IUPAC name is 3-(1,3-dimethylpyrazol-4-yl)-6-fluoro-5-methyl-1H-benzimidazole-2-thione.
| Compound Name | 3-(1,3-dimethylpyrazol-4-yl)-6-fluoro-5-methyl-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 103592537 |
| Molecular Formula | C13H13FN4S |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 3-(1,3-dimethylpyrazol-4-yl)-6-fluoro-5-methyl-1H-benzimidazole-2-thione |
| SMILES | Cc1cc2c(cc1F)[nH]c(=S)n2-c1cn(C)nc1C |
| InChI | InChI=1S/C13H13FN4S/c1-7-4-11-10(5-9(7)14)15-13(19)18(11)12-6-17(3)16-8(12)2/h4-6H,1-3H3,(H,15,19) |
| InChIKey | SXJWITMFOPAWIM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 38.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|