C19H17F2NS — CID 10359219
5-(3,5-difluorophenyl)spiro[1H-indole-3,1'-cyclohexane]-2-thione (PubChem CID 10359219) has the molecular formula C19H17F2NS and a molecular weight of 329.42 g/mol. Its IUPAC name is 5-(3,5-difluorophenyl)spiro[1H-indole-3,1'-cyclohexane]-2-thione.
| Compound Name | 5-(3,5-difluorophenyl)spiro[1H-indole-3,1'-cyclohexane]-2-thione |
|---|---|
| PubChem CID | 10359219 |
| Molecular Formula | C19H17F2NS |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 5-(3,5-difluorophenyl)spiro[1H-indole-3,1'-cyclohexane]-2-thione |
| SMILES | Fc1cc(F)cc(-c2ccc3c(c2)C2(CCCCC2)C(=S)N3)c1 |
| InChI | InChI=1S/C19H17F2NS/c20-14-8-13(9-15(21)11-14)12-4-5-17-16(10-12)19(18(23)22-17)6-2-1-3-7-19/h4-5,8-11H,1-3,6-7H2,(H,22,23) |
| InChIKey | IIHYJKOPTLVNPT-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|