C15H19FN4 — CID 103592630
1-(1-azabicyclo[2.2.2]octan-3-yl)-5-fluoro-6-methylbenzimidazol-2-amine (PubChem CID 103592630) has the molecular formula C15H19FN4 and a molecular weight of 274.34 g/mol. Its IUPAC name is 1-(1-azabicyclo[2.2.2]octan-3-yl)-5-fluoro-6-methylbenzimidazol-2-amine.
| Compound Name | 1-(1-azabicyclo[2.2.2]octan-3-yl)-5-fluoro-6-methylbenzimidazol-2-amine |
|---|---|
| PubChem CID | 103592630 |
| Molecular Formula | C15H19FN4 |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 1-(1-azabicyclo[2.2.2]octan-3-yl)-5-fluoro-6-methylbenzimidazol-2-amine |
| SMILES | Cc1cc2c(cc1F)nc(N)n2C1CN2CCC1CC2 |
| InChI | InChI=1S/C15H19FN4/c1-9-6-13-12(7-11(9)16)18-15(17)20(13)14-8-19-4-2-10(14)3-5-19/h6-7,10,14H,2-5,8H2,1H3,(H2,17,18) |
| InChIKey | VIOQEPTZOWDFON-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |