C13H16FN3S — CID 103593149
5-fluoro-6-methyl-1-(thian-3-yl)benzimidazol-2-amine (PubChem CID 103593149) has the molecular formula C13H16FN3S and a molecular weight of 265.36 g/mol. Its IUPAC name is 5-fluoro-6-methyl-1-(thian-3-yl)benzimidazol-2-amine.
| Compound Name | 5-fluoro-6-methyl-1-(thian-3-yl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 103593149 |
| Molecular Formula | C13H16FN3S |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 5-fluoro-6-methyl-1-(thian-3-yl)benzimidazol-2-amine |
| SMILES | Cc1cc2c(cc1F)nc(N)n2C1CCCSC1 |
| InChI | InChI=1S/C13H16FN3S/c1-8-5-12-11(6-10(8)14)16-13(15)17(12)9-3-2-4-18-7-9/h5-6,9H,2-4,7H2,1H3,(H2,15,16) |
| InChIKey | ARLVENJUJDBLBC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |