C16H23FN4 — CID 103592949
1-[2-[cyclopentyl(methyl)amino]ethyl]-5-fluoro-6-methylbenzimidazol-2-amine (PubChem CID 103592949) has the molecular formula C16H23FN4 and a molecular weight of 290.39 g/mol. Its IUPAC name is 1-[2-[cyclopentyl(methyl)amino]ethyl]-5-fluoro-6-methylbenzimidazol-2-amine.
| Compound Name | 1-[2-[cyclopentyl(methyl)amino]ethyl]-5-fluoro-6-methylbenzimidazol-2-amine |
|---|---|
| PubChem CID | 103592949 |
| Molecular Formula | C16H23FN4 |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 1-[2-[cyclopentyl(methyl)amino]ethyl]-5-fluoro-6-methylbenzimidazol-2-amine |
| SMILES | Cc1cc2c(cc1F)nc(N)n2CCN(C)C1CCCC1 |
| InChI | InChI=1S/C16H23FN4/c1-11-9-15-14(10-13(11)17)19-16(18)21(15)8-7-20(2)12-5-3-4-6-12/h9-10,12H,3-8H2,1-2H3,(H2,18,19) |
| InChIKey | DPDDORZQWYZTQG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |