C15H19ClN2S — CID 114281467
2-(1-chloroethyl)-5,6-dimethyl-1-(thiolan-3-yl)benzimidazole (PubChem CID 114281467) has the molecular formula C15H19ClN2S and a molecular weight of 294.85 g/mol. Its IUPAC name is 2-(1-chloroethyl)-5,6-dimethyl-1-(thiolan-3-yl)benzimidazole.
| Compound Name | 2-(1-chloroethyl)-5,6-dimethyl-1-(thiolan-3-yl)benzimidazole |
|---|---|
| PubChem CID | 114281467 |
| Molecular Formula | C15H19ClN2S |
| Molecular Weight | 294.85 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-(1-chloroethyl)-5,6-dimethyl-1-(thiolan-3-yl)benzimidazole |
| SMILES | Cc1cc2nc(C(C)Cl)n(C3CCSC3)c2cc1C |
| InChI | InChI=1S/C15H19ClN2S/c1-9-6-13-14(7-10(9)2)18(12-4-5-19-8-12)15(17-13)11(3)16/h6-7,11-12H,4-5,8H2,1-3H3 |
| InChIKey | LHWLYRCUOIJWOQ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.85 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|