C14H14ClF3N2S — CID 103063846
2-(1-chloroethyl)-1-(thiolan-3-yl)-5-(trifluoromethyl)benzimidazole (PubChem CID 103063846) has the molecular formula C14H14ClF3N2S and a molecular weight of 334.79 g/mol. Its IUPAC name is 2-(1-chloroethyl)-1-(thiolan-3-yl)-5-(trifluoromethyl)benzimidazole.
| Compound Name | 2-(1-chloroethyl)-1-(thiolan-3-yl)-5-(trifluoromethyl)benzimidazole |
|---|---|
| PubChem CID | 103063846 |
| Molecular Formula | C14H14ClF3N2S |
| Molecular Weight | 334.79 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 2-(1-chloroethyl)-1-(thiolan-3-yl)-5-(trifluoromethyl)benzimidazole |
| SMILES | CC(Cl)c1nc2cc(C(F)(F)F)ccc2n1C1CCSC1 |
| InChI | InChI=1S/C14H14ClF3N2S/c1-8(15)13-19-11-6-9(14(16,17)18)2-3-12(11)20(13)10-4-5-21-7-10/h2-3,6,8,10H,4-5,7H2,1H3 |
| InChIKey | UTJSRFXQFGMZSA-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.79 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|