C13H14ClIN2O — CID 80713559
2-(1-chloroethyl)-5-iodo-1-(oxolan-3-yl)benzimidazole (PubChem CID 80713559) has the molecular formula C13H14ClIN2O and a molecular weight of 376.63 g/mol. Its IUPAC name is 2-(1-chloroethyl)-5-iodo-1-(oxolan-3-yl)benzimidazole.
| Compound Name | 2-(1-chloroethyl)-5-iodo-1-(oxolan-3-yl)benzimidazole |
|---|---|
| PubChem CID | 80713559 |
| Molecular Formula | C13H14ClIN2O |
| Molecular Weight | 376.63 g/mol |
| Exact Mass | 375.98 |
| IUPAC Name | 2-(1-chloroethyl)-5-iodo-1-(oxolan-3-yl)benzimidazole |
| SMILES | CC(Cl)c1nc2cc(I)ccc2n1C1CCOC1 |
| InChI | InChI=1S/C13H14ClIN2O/c1-8(14)13-16-11-6-9(15)2-3-12(11)17(13)10-4-5-18-7-10/h2-3,6,8,10H,4-5,7H2,1H3 |
| InChIKey | UANWXUXWZOJQPP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.63 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|