C17H22ClIN2 — CID 66080093
2-(1-chloroethyl)-1-(3,4-dimethylcyclohexyl)-5-iodobenzimidazole (PubChem CID 66080093) has the molecular formula C17H22ClIN2 and a molecular weight of 416.73 g/mol. Its IUPAC name is 2-(1-chloroethyl)-1-(3,4-dimethylcyclohexyl)-5-iodobenzimidazole.
| Compound Name | 2-(1-chloroethyl)-1-(3,4-dimethylcyclohexyl)-5-iodobenzimidazole |
|---|---|
| PubChem CID | 66080093 |
| Molecular Formula | C17H22ClIN2 |
| Molecular Weight | 416.73 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | 2-(1-chloroethyl)-1-(3,4-dimethylcyclohexyl)-5-iodobenzimidazole |
| SMILES | CC(Cl)c1nc2cc(I)ccc2n1C1CCC(C)C(C)C1 |
| InChI | InChI=1S/C17H22ClIN2/c1-10-4-6-14(8-11(10)2)21-16-7-5-13(19)9-15(16)20-17(21)12(3)18/h5,7,9-12,14H,4,6,8H2,1-3H3 |
| InChIKey | DTQHKQIVLJRRFI-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.73 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|