About 2-(1-chloroethyl)-1-(3,3-dimethylcyclopentyl)-5-methylbenzimidazole
2-(1-chloroethyl)-1-(3,3-dimethylcyclopentyl)-5-methylbenzimidazole (PubChem CID 114548609) has the molecular formula C17H23ClN2
and a molecular weight of 290.84 g/mol. Its IUPAC name is 2-(1-chloroethyl)-1-(3,3-dimethylcyclopentyl)-5-methylbenzimidazole.
Molecular Properties
| Compound Name | 2-(1-chloroethyl)-1-(3,3-dimethylcyclopentyl)-5-methylbenzimidazole |
| PubChem CID | 114548609 |
| Molecular Formula | C17H23ClN2 |
| Molecular Weight | 290.84 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 2-(1-chloroethyl)-1-(3,3-dimethylcyclopentyl)-5-methylbenzimidazole |
| SMILES | Cc1ccc2c(c1)nc(C(C)Cl)n2C1CCC(C)(C)C1 |
| InChI | InChI=1S/C17H23ClN2/c1-11-5-6-15-14(9-11)19-16(12(2)18)20(15)13-7-8-17(3,4)10-13/h5-6,9,12-13H,7-8,10H2,1-4H3 |
| InChIKey | URQOIKYRLAZGTJ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.84 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-chloroethyl)-1-(3,3-dimethylcyclopentyl)-5-methylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-chloroethyl)-1-(3,3-dimethylcyclopentyl)-5-methylbenzimidazole?
The IUPAC name of 2-(1-chloroethyl)-1-(3,3-dimethylcyclopentyl)-5-methylbenzimidazole (CID 114548609) is 2-(1-chloroethyl)-1-(3,3-dimethylcyclopentyl)-5-methylbenzimidazole.
What is the SMILES notation for 2-(1-chloroethyl)-1-(3,3-dimethylcyclopentyl)-5-methylbenzimidazole?
The canonical SMILES for 2-(1-chloroethyl)-1-(3,3-dimethylcyclopentyl)-5-methylbenzimidazole is Cc1ccc2c(c1)nc(C(C)Cl)n2C1CCC(C)(C)C1.
What is the InChIKey of 2-(1-chloroethyl)-1-(3,3-dimethylcyclopentyl)-5-methylbenzimidazole?
The InChIKey is URQOIKYRLAZGTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23ClN2/c1-11-5-6-15-14(9-11)19-16(12(2)18)20(15)13-7-8-17(3,4)10-13/h5-6,9,12-13H,7-8,10H2,1-4H3.
What are the key properties of 2-(1-chloroethyl)-1-(3,3-dimethylcyclopentyl)-5-methylbenzimidazole?
2-(1-chloroethyl)-1-(3,3-dimethylcyclopentyl)-5-methylbenzimidazole has a molecular weight of 290.84 g/mol, XLogP of 5.40, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-chloroethyl)-1-(3,3-dimethylcyclopentyl)-5-methylbenzimidazole is sourced from PubChem (CID 114548609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).