C18H25ClN2 — CID 115553608
2-(1-chloroethyl)-1-(3,4-dimethylcyclohexyl)-7-methylbenzimidazole (PubChem CID 115553608) has the molecular formula C18H25ClN2 and a molecular weight of 304.87 g/mol. Its IUPAC name is 2-(1-chloroethyl)-1-(3,4-dimethylcyclohexyl)-7-methylbenzimidazole.
| Compound Name | 2-(1-chloroethyl)-1-(3,4-dimethylcyclohexyl)-7-methylbenzimidazole |
|---|---|
| PubChem CID | 115553608 |
| Molecular Formula | C18H25ClN2 |
| Molecular Weight | 304.87 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 2-(1-chloroethyl)-1-(3,4-dimethylcyclohexyl)-7-methylbenzimidazole |
| SMILES | Cc1cccc2nc(C(C)Cl)n(C3CCC(C)C(C)C3)c12 |
| InChI | InChI=1S/C18H25ClN2/c1-11-8-9-15(10-13(11)3)21-17-12(2)6-5-7-16(17)20-18(21)14(4)19/h5-7,11,13-15H,8-10H2,1-4H3 |
| InChIKey | DXWXKAAWRWVNJG-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.87 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|