C18H19ClN2 — CID 115552861
2-(1-chloroethyl)-1-(3,4-dimethylphenyl)-7-methylbenzimidazole (PubChem CID 115552861) has the molecular formula C18H19ClN2 and a molecular weight of 298.82 g/mol. Its IUPAC name is 2-(1-chloroethyl)-1-(3,4-dimethylphenyl)-7-methylbenzimidazole.
| Compound Name | 2-(1-chloroethyl)-1-(3,4-dimethylphenyl)-7-methylbenzimidazole |
|---|---|
| PubChem CID | 115552861 |
| Molecular Formula | C18H19ClN2 |
| Molecular Weight | 298.82 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2-(1-chloroethyl)-1-(3,4-dimethylphenyl)-7-methylbenzimidazole |
| SMILES | Cc1ccc(-n2c(C(C)Cl)nc3cccc(C)c32)cc1C |
| InChI | InChI=1S/C18H19ClN2/c1-11-8-9-15(10-13(11)3)21-17-12(2)6-5-7-16(17)20-18(21)14(4)19/h5-10,14H,1-4H3 |
| InChIKey | GUUKOAPTUMJTFU-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.82 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|