C16H16ClN3 — CID 79292083
2-(1-chloroethyl)-1-(3,4-dimethylphenyl)imidazo[4,5-c]pyridine (PubChem CID 79292083) has the molecular formula C16H16ClN3 and a molecular weight of 285.78 g/mol. Its IUPAC name is 2-(1-chloroethyl)-1-(3,4-dimethylphenyl)imidazo[4,5-c]pyridine.
| Compound Name | 2-(1-chloroethyl)-1-(3,4-dimethylphenyl)imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 79292083 |
| Molecular Formula | C16H16ClN3 |
| Molecular Weight | 285.78 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2-(1-chloroethyl)-1-(3,4-dimethylphenyl)imidazo[4,5-c]pyridine |
| SMILES | Cc1ccc(-n2c(C(C)Cl)nc3cnccc32)cc1C |
| InChI | InChI=1S/C16H16ClN3/c1-10-4-5-13(8-11(10)2)20-15-6-7-18-9-14(15)19-16(20)12(3)17/h4-9,12H,1-3H3 |
| InChIKey | ZNVNQHJJCIAJEJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.78 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|